C18H17BrN2O4S2 — CID 126565460
methyl (3S,11S,14S)-8-bromo-14,18-dimethyl-13,17-dioxo-15,16-dithia-12,18-diazapentacyclo[12.2.2.01,12.03,11.05,10]octadeca-5(10),6,8-triene-3-carboxylate (PubChem CID 126565460) has the molecular formula C18H17BrN2O4S2 and a molecular weight of 469.38 g/mol. Its IUPAC name is methyl (3S,11S,14S)-8-bromo-14,18-dimethyl-13,17-dioxo-15,16-dithia-12,18-diazapentacyclo[12.2.2.01,12.03,11.05,10]octadeca-5(10),6,8-triene-3-carboxylate.
| Compound Name | methyl (3S,11S,14S)-8-bromo-14,18-dimethyl-13,17-dioxo-15,16-dithia-12,18-diazapentacyclo[12.2.2.01,12.03,11.05,10]octadeca-5(10),6,8-triene-3-carboxylate |
|---|---|
| PubChem CID | 126565460 |
| Molecular Formula | C18H17BrN2O4S2 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | methyl (3S,11S,14S)-8-bromo-14,18-dimethyl-13,17-dioxo-15,16-dithia-12,18-diazapentacyclo[12.2.2.01,12.03,11.05,10]octadeca-5(10),6,8-triene-3-carboxylate |
| SMILES | COC(=O)[C@]12Cc3ccc(Br)cc3[C@@H]1N1C(=O)[C@]3(C)SSC1(C2)C(=O)N3C |
| InChI | InChI=1S/C18H17BrN2O4S2/c1-16-13(22)21-12-11-6-10(19)5-4-9(11)7-17(12,15(24)25-3)8-18(21,27-26-16)14(23)20(16)2/h4-6,12H,7-8H2,1-3H3/t12-,16-,17-,18?/m0/s1 |
| InChIKey | IFTRJHRHVSRAIE-DSHDYTRZSA-N |
| XLogP | 2.72 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|