C18H18BrN3O3S — CID 134578564
(1S,3S,4R,7S)-4-(2-bromo-5-methoxyphenyl)-3,7,8-trimethyl-6,9-dioxo-10-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile (PubChem CID 134578564) has the molecular formula C18H18BrN3O3S and a molecular weight of 436.33 g/mol. Its IUPAC name is (1S,3S,4R,7S)-4-(2-bromo-5-methoxyphenyl)-3,7,8-trimethyl-6,9-dioxo-10-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile.
| Compound Name | (1S,3S,4R,7S)-4-(2-bromo-5-methoxyphenyl)-3,7,8-trimethyl-6,9-dioxo-10-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
|---|---|
| PubChem CID | 134578564 |
| Molecular Formula | C18H18BrN3O3S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | (1S,3S,4R,7S)-4-(2-bromo-5-methoxyphenyl)-3,7,8-trimethyl-6,9-dioxo-10-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
| SMILES | COc1ccc(Br)c([C@@H]2N3C(=O)[C@]4(C)S[C@@]3(C[C@]2(C)C#N)C(=O)N4C)c1 |
| InChI | InChI=1S/C18H18BrN3O3S/c1-16(9-20)8-18-15(24)21(3)17(2,26-18)14(23)22(18)13(16)11-7-10(25-4)5-6-12(11)19/h5-7,13H,8H2,1-4H3/t13-,16+,17-,18-/m0/s1 |
| InChIKey | BHQLTUOAAIAJID-NBMRYCAZSA-N |
| XLogP | 2.89 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |