C12H10MgO9S3 — CID 126569140
CID 126569140 (PubChem CID 126569140) has the molecular formula C12H10MgO9S3 and a molecular weight of 418.71 g/mol.
| Compound Name | CID 126569140 |
|---|---|
| PubChem CID | 126569140 |
| Molecular Formula | C12H10MgO9S3 |
| Molecular Weight | 418.71 g/mol |
| Exact Mass | 417.93 |
| IUPAC Name | — |
| SMILES | C=Cc1c(S(=O)(=O)O)c(S(=O)(=O)O)c(S(=O)(=O)O)c2ccccc12.[Mg] |
| InChI | InChI=1S/C12H10O9S3.Mg/c1-2-7-8-5-3-4-6-9(8)11(23(16,17)18)12(24(19,20)21)10(7)22(13,14)15;/h2-6H,1H2,(H,13,14,15)(H,16,17,18)(H,19,20,21); |
| InChIKey | UJHNZMUEUFPRQC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.71 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|