C21H31BrN2O2 — CID 126589849
propan-2-yl 2-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-bromo-2,6-dimethyl-3-pyridinyl]acetate (PubChem CID 126589849) has the molecular formula C21H31BrN2O2 and a molecular weight of 423.40 g/mol. Its IUPAC name is propan-2-yl 2-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-bromo-2,6-dimethyl-3-pyridinyl]acetate.
| Compound Name | propan-2-yl 2-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-bromo-2,6-dimethyl-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 126589849 |
| Molecular Formula | C21H31BrN2O2 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | propan-2-yl 2-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-bromo-2,6-dimethyl-3-pyridinyl]acetate |
| SMILES | Cc1nc(C)c(CC(=O)OC(C)C)c(N2CCC3CCCCC3C2)c1Br |
| InChI | InChI=1S/C21H31BrN2O2/c1-13(2)26-19(25)11-18-14(3)23-15(4)20(22)21(18)24-10-9-16-7-5-6-8-17(16)12-24/h13,16-17H,5-12H2,1-4H3 |
| InChIKey | FEVUPOUXAFCGTJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |