C21H21BrFN3O3 — CID 126592766
2-[3-[2-amino-2-(3-bromo-4-fluorophenyl)iminoacetyl]cyclobutyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 126592766) has the molecular formula C21H21BrFN3O3 and a molecular weight of 462.32 g/mol. Its IUPAC name is 2-[3-[2-amino-2-(3-bromo-4-fluorophenyl)iminoacetyl]cyclobutyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[3-[2-amino-2-(3-bromo-4-fluorophenyl)iminoacetyl]cyclobutyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126592766 |
| Molecular Formula | C21H21BrFN3O3 |
| Molecular Weight | 462.32 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[3-[2-amino-2-(3-bromo-4-fluorophenyl)iminoacetyl]cyclobutyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2CC(C(=O)/C(N)=N/c3ccc(F)c(Br)c3)C2)cc1 |
| InChI | InChI=1S/C21H21BrFN3O3/c1-29-16-5-2-14(3-6-16)25-19(27)10-12-8-13(9-12)20(28)21(24)26-15-4-7-18(23)17(22)11-15/h2-7,11-13H,8-10H2,1H3,(H2,24,26)(H,25,27) |
| InChIKey | HDJLGFDNFNXDJT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|