C18H22BrF2N3O3 — CID 126593003
tert-butyl 4-[2-amino-2-(3-bromo-2,4-difluorophenyl)iminoacetyl]piperidine-1-carboxylate (PubChem CID 126593003) has the molecular formula C18H22BrF2N3O3 and a molecular weight of 446.29 g/mol. Its IUPAC name is tert-butyl 4-[2-amino-2-(3-bromo-2,4-difluorophenyl)iminoacetyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-amino-2-(3-bromo-2,4-difluorophenyl)iminoacetyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126593003 |
| Molecular Formula | C18H22BrF2N3O3 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | tert-butyl 4-[2-amino-2-(3-bromo-2,4-difluorophenyl)iminoacetyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)/C(N)=N/c2ccc(F)c(Br)c2F)CC1 |
| InChI | InChI=1S/C18H22BrF2N3O3/c1-18(2,3)27-17(26)24-8-6-10(7-9-24)15(25)16(22)23-12-5-4-11(20)13(19)14(12)21/h4-5,10H,6-9H2,1-3H3,(H2,22,23) |
| InChIKey | USZPRVAOUIXMBW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|