C7H10NO4P — CID 126593273
phosphanyl 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate (PubChem CID 126593273) has the molecular formula C7H10NO4P and a molecular weight of 203.13 g/mol. Its IUPAC name is phosphanyl 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate.
| Compound Name | phosphanyl 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 126593273 |
| Molecular Formula | C7H10NO4P |
| Molecular Weight | 203.13 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | phosphanyl 3-[[(Z)-4-oxobut-2-enoyl]amino]propanoate |
| SMILES | O=C/C=C\C(=O)NCCC(=O)OP |
| InChI | InChI=1S/C7H10NO4P/c9-5-1-2-6(10)8-4-3-7(11)12-13/h1-2,5H,3-4,13H2,(H,8,10)/b2-1- |
| InChIKey | UQSIWRRRAVPKJT-UPHRSURJSA-N |
| XLogP | -0.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.13 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|