C9H11N3O5 — CID 138599210
(Z)-N-[2-[(2-formamido-2-oxoethyl)amino]-2-oxoethyl]-4-oxobut-2-enamide (PubChem CID 138599210) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is (Z)-N-[2-[(2-formamido-2-oxoethyl)amino]-2-oxoethyl]-4-oxobut-2-enamide.
| Compound Name | (Z)-N-[2-[(2-formamido-2-oxoethyl)amino]-2-oxoethyl]-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 138599210 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | (Z)-N-[2-[(2-formamido-2-oxoethyl)amino]-2-oxoethyl]-4-oxobut-2-enamide |
| SMILES | O=C/C=C\C(=O)NCC(=O)NCC(=O)NC=O |
| InChI | InChI=1S/C9H11N3O5/c13-3-1-2-7(15)10-4-8(16)11-5-9(17)12-6-14/h1-3,6H,4-5H2,(H,10,15)(H,11,16)(H,12,14,17)/b2-1- |
| InChIKey | RLRJXHSPVRHNMD-UPHRSURJSA-N |
| XLogP | -2.75 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|