C13H27N5O2 — CID 126595824
tert-butyl N-[(Z)-2-amino-3-[(N'-butylcarbamimidoyl)amino]prop-2-enyl]carbamate (PubChem CID 126595824) has the molecular formula C13H27N5O2 and a molecular weight of 285.39 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-amino-3-[(N'-butylcarbamimidoyl)amino]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-amino-3-[(N'-butylcarbamimidoyl)amino]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 126595824 |
| Molecular Formula | C13H27N5O2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | tert-butyl N-[(Z)-2-amino-3-[(N'-butylcarbamimidoyl)amino]prop-2-enyl]carbamate |
| SMILES | CCCC/N=C(\N)N/C=C(\N)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H27N5O2/c1-5-6-7-16-11(15)17-8-10(14)9-18-12(19)20-13(2,3)4/h8H,5-7,9,14H2,1-4H3,(H,18,19)(H3,15,16,17)/b10-8- |
| InChIKey | RHNJOGRWGXZKBP-NTMALXAHSA-N |
| XLogP | 1.02 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|