C22H26N2O10 — CID 126597451
2-[2-[[carboxy-(2-hydroxyphenyl)methyl]-(carboxymethyl)amino]ethyl-(2,2-dihydroxyethyl)amino]-2-(2-hydroxyphenyl)acetic acid (PubChem CID 126597451) has the molecular formula C22H26N2O10 and a molecular weight of 478.45 g/mol. Its IUPAC name is 2-[2-[[carboxy-(2-hydroxyphenyl)methyl]-(carboxymethyl)amino]ethyl-(2,2-dihydroxyethyl)amino]-2-(2-hydroxyphenyl)acetic acid.
| Compound Name | 2-[2-[[carboxy-(2-hydroxyphenyl)methyl]-(carboxymethyl)amino]ethyl-(2,2-dihydroxyethyl)amino]-2-(2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 126597451 |
| Molecular Formula | C22H26N2O10 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-[2-[[carboxy-(2-hydroxyphenyl)methyl]-(carboxymethyl)amino]ethyl-(2,2-dihydroxyethyl)amino]-2-(2-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)CN(CCN(CC(O)O)C(C(=O)O)c1ccccc1O)C(C(=O)O)c1ccccc1O |
| InChI | InChI=1S/C22H26N2O10/c25-15-7-3-1-5-13(15)19(21(31)32)23(11-17(27)28)9-10-24(12-18(29)30)20(22(33)34)14-6-2-4-8-16(14)26/h1-8,17,19-20,25-28H,9-12H2,(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | QZJNTGANKUIBSN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 199.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|