C19H24N2O2S2 — CID 126602075
1-[2-(2,4-dimethylphenyl)sulfanylphenyl]-4-methylsulfonylpiperazine (PubChem CID 126602075) has the molecular formula C19H24N2O2S2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]-4-methylsulfonylpiperazine.
| Compound Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]-4-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 126602075 |
| Molecular Formula | C19H24N2O2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]-4-methylsulfonylpiperazine |
| SMILES | Cc1ccc(Sc2ccccc2N2CCN(S(C)(=O)=O)CC2)c(C)c1 |
| InChI | InChI=1S/C19H24N2O2S2/c1-15-8-9-18(16(2)14-15)24-19-7-5-4-6-17(19)20-10-12-21(13-11-20)25(3,22)23/h4-9,14H,10-13H2,1-3H3 |
| InChIKey | DNHGSCQYPGYVRR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |