C28H29N — CID 126602598
2-ethyl-N,6-dimethyl-N-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]aniline (PubChem CID 126602598) has the molecular formula C28H29N and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-ethyl-N,6-dimethyl-N-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]aniline.
| Compound Name | 2-ethyl-N,6-dimethyl-N-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]aniline |
|---|---|
| PubChem CID | 126602598 |
| Molecular Formula | C28H29N |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-ethyl-N,6-dimethyl-N-[4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]phenyl]aniline |
| SMILES | CCc1cccc(C)c1N(C)c1ccc(/C=C/C=C/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N/c1-4-26-18-12-13-23(2)28(26)29(3)27-21-19-25(20-22-27)17-9-6-5-8-14-24-15-10-7-11-16-24/h5-22H,4H2,1-3H3/b6-5+,14-8+,17-9+ |
| InChIKey | YGEPOAWVKABVHB-NGRFPNIPSA-N |
| XLogP | 7.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|