C15H19NO2S3 — CID 126604691
ethyl 4,4-dimethyl-8-methylsulfanyl-3,5-dihydro-2H-thieno[3,4-g][1,2]benzothiazole-6-carboxylate (PubChem CID 126604691) has the molecular formula C15H19NO2S3 and a molecular weight of 341.52 g/mol. Its IUPAC name is ethyl 4,4-dimethyl-8-methylsulfanyl-3,5-dihydro-2H-thieno[3,4-g][1,2]benzothiazole-6-carboxylate.
| Compound Name | ethyl 4,4-dimethyl-8-methylsulfanyl-3,5-dihydro-2H-thieno[3,4-g][1,2]benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 126604691 |
| Molecular Formula | C15H19NO2S3 |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | ethyl 4,4-dimethyl-8-methylsulfanyl-3,5-dihydro-2H-thieno[3,4-g][1,2]benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1sc(SC)c2c1CC(C)(C)C1=C2SNC1 |
| InChI | InChI=1S/C15H19NO2S3/c1-5-18-13(17)11-8-6-15(2,3)9-7-16-21-12(9)10(8)14(19-4)20-11/h16H,5-7H2,1-4H3 |
| InChIKey | KIBYCKNLSYVIFD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|