C15H18O4S2 — CID 70033765
ethyl (5E)-5-(hydroxymethylidene)-6,6-dimethyl-3-methylsulfanyl-4-oxo-7H-2-benzothiophene-1-carboxylate (PubChem CID 70033765) has the molecular formula C15H18O4S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is ethyl (5E)-5-(hydroxymethylidene)-6,6-dimethyl-3-methylsulfanyl-4-oxo-7H-2-benzothiophene-1-carboxylate.
| Compound Name | ethyl (5E)-5-(hydroxymethylidene)-6,6-dimethyl-3-methylsulfanyl-4-oxo-7H-2-benzothiophene-1-carboxylate |
|---|---|
| PubChem CID | 70033765 |
| Molecular Formula | C15H18O4S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | ethyl (5E)-5-(hydroxymethylidene)-6,6-dimethyl-3-methylsulfanyl-4-oxo-7H-2-benzothiophene-1-carboxylate |
| SMILES | CCOC(=O)c1sc(SC)c2c1CC(C)(C)/C(=C\O)C2=O |
| InChI | InChI=1S/C15H18O4S2/c1-5-19-13(18)12-8-6-15(2,3)9(7-16)11(17)10(8)14(20-4)21-12/h7,16H,5-6H2,1-4H3/b9-7- |
| InChIKey | FAIHXFFPCUKKHZ-CLFYSBASSA-N |
| XLogP | 3.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|