C12H13BrO3S2 — CID 15885619
ethyl 5-bromo-3-methylsulfanyl-4-oxo-6,7-dihydro-5H-2-benzothiophene-1-carboxylate (PubChem CID 15885619) has the molecular formula C12H13BrO3S2 and a molecular weight of 349.27 g/mol. Its IUPAC name is ethyl 5-bromo-3-methylsulfanyl-4-oxo-6,7-dihydro-5H-2-benzothiophene-1-carboxylate.
| Compound Name | ethyl 5-bromo-3-methylsulfanyl-4-oxo-6,7-dihydro-5H-2-benzothiophene-1-carboxylate |
|---|---|
| PubChem CID | 15885619 |
| Molecular Formula | C12H13BrO3S2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | ethyl 5-bromo-3-methylsulfanyl-4-oxo-6,7-dihydro-5H-2-benzothiophene-1-carboxylate |
| SMILES | CCOC(=O)c1sc(SC)c2c1CCC(Br)C2=O |
| InChI | InChI=1S/C12H13BrO3S2/c1-3-16-11(15)10-6-4-5-7(13)9(14)8(6)12(17-2)18-10/h7H,3-5H2,1-2H3 |
| InChIKey | AIDQSXDEJSFUPR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|