C16H26NO7PS — CID 126605388
3-(4-diethoxyphosphorylthiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 126605388) has the molecular formula C16H26NO7PS and a molecular weight of 407.43 g/mol. Its IUPAC name is 3-(4-diethoxyphosphorylthiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | 3-(4-diethoxyphosphorylthiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 126605388 |
| Molecular Formula | C16H26NO7PS |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-(4-diethoxyphosphorylthiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CCOP(=O)(OCC)c1csc(CC(NC(=O)OC(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C16H26NO7PS/c1-6-22-25(21,23-7-2)11-8-12(26-10-11)9-13(14(18)19)17-15(20)24-16(3,4)5/h8,10,13H,6-7,9H2,1-5H3,(H,17,20)(H,18,19) |
| InChIKey | FKESGBLCXUIRTB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|