C15H11Cl2F2O2PS — CID 126607225
[(E)-3-(benzenesulfonyl)-2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enyl]phosphane (PubChem CID 126607225) has the molecular formula C15H11Cl2F2O2PS and a molecular weight of 395.19 g/mol. Its IUPAC name is [(E)-3-(benzenesulfonyl)-2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enyl]phosphane.
| Compound Name | [(E)-3-(benzenesulfonyl)-2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enyl]phosphane |
|---|---|
| PubChem CID | 126607225 |
| Molecular Formula | C15H11Cl2F2O2PS |
| Molecular Weight | 395.19 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | [(E)-3-(benzenesulfonyl)-2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enyl]phosphane |
| SMILES | O=S(=O)(/C=C(\c1cc(Cl)cc(Cl)c1)C(F)(F)P)c1ccccc1 |
| InChI | InChI=1S/C15H11Cl2F2O2PS/c16-11-6-10(7-12(17)8-11)14(15(18,19)22)9-23(20,21)13-4-2-1-3-5-13/h1-9H,22H2/b14-9+ |
| InChIKey | XGWOQSXUQDTLSA-NTEUORMPSA-N |
| XLogP | 5.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.19 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|