C16H33F — CID 126608201
6,6-diethyl-5-fluoro-3,4-dimethyldecane (PubChem CID 126608201) has the molecular formula C16H33F and a molecular weight of 244.44 g/mol. Its IUPAC name is 6,6-diethyl-5-fluoro-3,4-dimethyldecane.
| Compound Name | 6,6-diethyl-5-fluoro-3,4-dimethyldecane |
|---|---|
| PubChem CID | 126608201 |
| Molecular Formula | C16H33F |
| Molecular Weight | 244.44 g/mol |
| Exact Mass | 244.26 |
| IUPAC Name | 6,6-diethyl-5-fluoro-3,4-dimethyldecane |
| SMILES | CCCCC(CC)(CC)C(F)C(C)C(C)CC |
| InChI | InChI=1S/C16H33F/c1-7-11-12-16(9-3,10-4)15(17)14(6)13(5)8-2/h13-15H,7-12H2,1-6H3 |
| InChIKey | JKYQJBGITRWHCW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |