C19H35NO2 — CID 126608531
1-[(3R,4R,5S)-5-amino-4-methyl-3-pentan-3-yloxycyclohexen-1-yl]heptan-1-one (PubChem CID 126608531) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is 1-[(3R,4R,5S)-5-amino-4-methyl-3-pentan-3-yloxycyclohexen-1-yl]heptan-1-one.
| Compound Name | 1-[(3R,4R,5S)-5-amino-4-methyl-3-pentan-3-yloxycyclohexen-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 126608531 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | 1-[(3R,4R,5S)-5-amino-4-methyl-3-pentan-3-yloxycyclohexen-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)C1=C[C@@H](OC(CC)CC)[C@H](C)[C@@H](N)C1 |
| InChI | InChI=1S/C19H35NO2/c1-5-8-9-10-11-18(21)15-12-17(20)14(4)19(13-15)22-16(6-2)7-3/h13-14,16-17,19H,5-12,20H2,1-4H3/t14-,17+,19-/m1/s1 |
| InChIKey | AIGJWQSZNQZWQB-DKSSEZFCSA-N |
| XLogP | 4.39 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|