C15H29O4P — CID 143771112
[(3S,4R,5S)-4,5-dimethyl-3-pentan-3-yloxycyclohexen-1-yl]-ethoxyphosphinic acid (PubChem CID 143771112) has the molecular formula C15H29O4P and a molecular weight of 304.37 g/mol. Its IUPAC name is [(3S,4R,5S)-4,5-dimethyl-3-pentan-3-yloxycyclohexen-1-yl]-ethoxyphosphinic acid.
| Compound Name | [(3S,4R,5S)-4,5-dimethyl-3-pentan-3-yloxycyclohexen-1-yl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 143771112 |
| Molecular Formula | C15H29O4P |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [(3S,4R,5S)-4,5-dimethyl-3-pentan-3-yloxycyclohexen-1-yl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C1=C[C@@H](OC(CC)CC)[C@H](C)[C@@H](C)C1 |
| InChI | InChI=1S/C15H29O4P/c1-6-13(7-2)19-15-10-14(9-11(4)12(15)5)20(16,17)18-8-3/h10-13,15H,6-9H2,1-5H3,(H,16,17)/t11-,12+,15+/m0/s1 |
| InChIKey | OIGCMICGLVVEFJ-YWPYICTPSA-N |
| XLogP | 4.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|