C31H42O6S2 — CID 126608950
1-O-(5,6-dihydroxyhexyl) 5-O-methyl 4-(benzenecarbonothioylsulfanyl)-2,4-dimethyl-2-(2-methyl-2-phenylpropyl)pentanedioate (PubChem CID 126608950) has the molecular formula C31H42O6S2 and a molecular weight of 574.81 g/mol. Its IUPAC name is 1-O-(5,6-dihydroxyhexyl) 5-O-methyl 4-(benzenecarbonothioylsulfanyl)-2,4-dimethyl-2-(2-methyl-2-phenylpropyl)pentanedioate.
| Compound Name | 1-O-(5,6-dihydroxyhexyl) 5-O-methyl 4-(benzenecarbonothioylsulfanyl)-2,4-dimethyl-2-(2-methyl-2-phenylpropyl)pentanedioate |
|---|---|
| PubChem CID | 126608950 |
| Molecular Formula | C31H42O6S2 |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 1-O-(5,6-dihydroxyhexyl) 5-O-methyl 4-(benzenecarbonothioylsulfanyl)-2,4-dimethyl-2-(2-methyl-2-phenylpropyl)pentanedioate |
| SMILES | COC(=O)C(C)(CC(C)(CC(C)(C)c1ccccc1)C(=O)OCCCCC(O)CO)SC(=S)c1ccccc1 |
| InChI | InChI=1S/C31H42O6S2/c1-29(2,24-16-10-7-11-17-24)21-30(3,27(34)37-19-13-12-18-25(33)20-32)22-31(4,28(35)36-5)39-26(38)23-14-8-6-9-15-23/h6-11,14-17,25,32-33H,12-13,18-22H2,1-5H3 |
| InChIKey | VFJUWSIWONJSDO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|