C22H37NO4S2Si3 — CID 123689881
[methyl-bis(trimethylsilyloxy)silyl] 2-(benzenecarbonothioylsulfanyl)-4-isocyano-2,4-dimethylpentanoate (PubChem CID 123689881) has the molecular formula C22H37NO4S2Si3 and a molecular weight of 527.93 g/mol. Its IUPAC name is [methyl-bis(trimethylsilyloxy)silyl] 2-(benzenecarbonothioylsulfanyl)-4-isocyano-2,4-dimethylpentanoate.
| Compound Name | [methyl-bis(trimethylsilyloxy)silyl] 2-(benzenecarbonothioylsulfanyl)-4-isocyano-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 123689881 |
| Molecular Formula | C22H37NO4S2Si3 |
| Molecular Weight | 527.93 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | [methyl-bis(trimethylsilyloxy)silyl] 2-(benzenecarbonothioylsulfanyl)-4-isocyano-2,4-dimethylpentanoate |
| SMILES | [C-]#[N+]C(C)(C)CC(C)(SC(=S)c1ccccc1)C(=O)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H37NO4S2Si3/c1-21(2,23-4)17-22(3,29-19(28)18-15-13-12-14-16-18)20(24)25-32(11,26-30(5,6)7)27-31(8,9)10/h12-16H,17H2,1-3,5-11H3 |
| InChIKey | SORRIFAIGLLKLS-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 49.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.93 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|