C22H24N2O2S — CID 126609672
[(E)-[1-(1,2-dimethyl-5-methylsulfanylindol-3-yl)-2-(2-methylphenyl)ethylidene]amino] acetate (PubChem CID 126609672) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is [(E)-[1-(1,2-dimethyl-5-methylsulfanylindol-3-yl)-2-(2-methylphenyl)ethylidene]amino] acetate.
| Compound Name | [(E)-[1-(1,2-dimethyl-5-methylsulfanylindol-3-yl)-2-(2-methylphenyl)ethylidene]amino] acetate |
|---|---|
| PubChem CID | 126609672 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [(E)-[1-(1,2-dimethyl-5-methylsulfanylindol-3-yl)-2-(2-methylphenyl)ethylidene]amino] acetate |
| SMILES | CSc1ccc2c(c1)c(/C(Cc1ccccc1C)=N/OC(C)=O)c(C)n2C |
| InChI | InChI=1S/C22H24N2O2S/c1-14-8-6-7-9-17(14)12-20(23-26-16(3)25)22-15(2)24(4)21-11-10-18(27-5)13-19(21)22/h6-11,13H,12H2,1-5H3/b23-20+ |
| InChIKey | FKHXSVMRHXGKEG-BSYVCWPDSA-N |
| XLogP | 5.03 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|