C13H15F2NO — CID 126610897
2-(butoxymethyl)-5,6-difluoro-1H-indole (PubChem CID 126610897) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-(butoxymethyl)-5,6-difluoro-1H-indole.
| Compound Name | 2-(butoxymethyl)-5,6-difluoro-1H-indole |
|---|---|
| PubChem CID | 126610897 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-(butoxymethyl)-5,6-difluoro-1H-indole |
| SMILES | CCCCOCc1cc2cc(F)c(F)cc2[nH]1 |
| InChI | InChI=1S/C13H15F2NO/c1-2-3-4-17-8-10-5-9-6-11(14)12(15)7-13(9)16-10/h5-7,16H,2-4,8H2,1H3 |
| InChIKey | CNMFFQNWIFTYLE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|