C20H18N4O — CID 126611433
(E)-N-(2-aminophenyl)-3-[1-[(E)-2-phenylethenyl]pyrazol-4-yl]prop-2-enamide (PubChem CID 126611433) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[1-[(E)-2-phenylethenyl]pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[1-[(E)-2-phenylethenyl]pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126611433 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[1-[(E)-2-phenylethenyl]pyrazol-4-yl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1cnn(/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C20H18N4O/c21-18-8-4-5-9-19(18)23-20(25)11-10-17-14-22-24(15-17)13-12-16-6-2-1-3-7-16/h1-15H,21H2,(H,23,25)/b11-10+,13-12+ |
| InChIKey | USGHWGNGYJNQNK-AQASXUMVSA-N |
| XLogP | 3.75 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|