C26H22N4OS — CID 142065104
(E)-N-(2-aminophenyl)-3-[6-[(4-phenylphenyl)sulfanylamino]-3-pyridinyl]prop-2-enamide (PubChem CID 142065104) has the molecular formula C26H22N4OS and a molecular weight of 438.56 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[6-[(4-phenylphenyl)sulfanylamino]-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[6-[(4-phenylphenyl)sulfanylamino]-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 142065104 |
| Molecular Formula | C26H22N4OS |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[6-[(4-phenylphenyl)sulfanylamino]-3-pyridinyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(NSc2ccc(-c3ccccc3)cc2)nc1 |
| InChI | InChI=1S/C26H22N4OS/c27-23-8-4-5-9-24(23)29-26(31)17-11-19-10-16-25(28-18-19)30-32-22-14-12-21(13-15-22)20-6-2-1-3-7-20/h1-18H,27H2,(H,28,30)(H,29,31)/b17-11+ |
| InChIKey | GQLGTHXVTKFLDD-GZTJUZNOSA-N |
| XLogP | 6.10 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|