C21H21N3O4 — CID 126613284
1-[(3S,3aR,6S,6aR)-3-cyano-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-(4-phenylmethoxyphenyl)urea (PubChem CID 126613284) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aR)-3-cyano-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-(4-phenylmethoxyphenyl)urea.
| Compound Name | 1-[(3S,3aR,6S,6aR)-3-cyano-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-(4-phenylmethoxyphenyl)urea |
|---|---|
| PubChem CID | 126613284 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[(3S,3aR,6S,6aR)-3-cyano-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-(4-phenylmethoxyphenyl)urea |
| SMILES | N#C[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2NC(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c22-10-15-12-27-20-18(13-28-19(15)20)24-21(25)23-16-6-8-17(9-7-16)26-11-14-4-2-1-3-5-14/h1-9,15,18-20H,11-13H2,(H2,23,24,25)/t15-,18-,19+,20+/m0/s1 |
| InChIKey | AKIHWTRAUUULOG-KCUHQSDYSA-N |
| XLogP | 2.69 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |