C21H50N6 — CID 126621384
2-methyl-1-N,5-N-bis[2-[2-(propan-2-ylamino)ethylamino]ethyl]hexane-1,5-diamine (PubChem CID 126621384) has the molecular formula C21H50N6 and a molecular weight of 386.67 g/mol. Its IUPAC name is 2-methyl-1-N,5-N-bis[2-[2-(propan-2-ylamino)ethylamino]ethyl]hexane-1,5-diamine.
| Compound Name | 2-methyl-1-N,5-N-bis[2-[2-(propan-2-ylamino)ethylamino]ethyl]hexane-1,5-diamine |
|---|---|
| PubChem CID | 126621384 |
| Molecular Formula | C21H50N6 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.41 |
| IUPAC Name | 2-methyl-1-N,5-N-bis[2-[2-(propan-2-ylamino)ethylamino]ethyl]hexane-1,5-diamine |
| SMILES | CC(CCC(C)NCCNCCNC(C)C)CNCCNCCNC(C)C |
| InChI | InChI=1S/C21H50N6/c1-18(2)25-14-11-22-9-10-24-17-20(5)7-8-21(6)27-16-13-23-12-15-26-19(3)4/h18-27H,7-17H2,1-6H3 |
| InChIKey | FVLQEZCTTCWSFS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|