C23H29F3O — CID 126626598
4-tert-butyl-1-methyl-2-[3-methyl-3-[4-(trifluoromethyl)phenyl]butoxy]benzene (PubChem CID 126626598) has the molecular formula C23H29F3O and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-tert-butyl-1-methyl-2-[3-methyl-3-[4-(trifluoromethyl)phenyl]butoxy]benzene.
| Compound Name | 4-tert-butyl-1-methyl-2-[3-methyl-3-[4-(trifluoromethyl)phenyl]butoxy]benzene |
|---|---|
| PubChem CID | 126626598 |
| Molecular Formula | C23H29F3O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-tert-butyl-1-methyl-2-[3-methyl-3-[4-(trifluoromethyl)phenyl]butoxy]benzene |
| SMILES | Cc1ccc(C(C)(C)C)cc1OCCC(C)(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H29F3O/c1-16-7-8-19(21(2,3)4)15-20(16)27-14-13-22(5,6)17-9-11-18(12-10-17)23(24,25)26/h7-12,15H,13-14H2,1-6H3 |
| InChIKey | NCESKOQYFMFOEP-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |