C18H22F6O — CID 126627031
1-[(3E,5Z)-4,6-difluoro-5-(1,1,3,3-tetrafluoroprop-2-enoxy)hexa-1,3,5-trien-2-yl]-4-propylcyclohexane (PubChem CID 126627031) has the molecular formula C18H22F6O and a molecular weight of 368.36 g/mol. Its IUPAC name is 1-[(3E,5Z)-4,6-difluoro-5-(1,1,3,3-tetrafluoroprop-2-enoxy)hexa-1,3,5-trien-2-yl]-4-propylcyclohexane.
| Compound Name | 1-[(3E,5Z)-4,6-difluoro-5-(1,1,3,3-tetrafluoroprop-2-enoxy)hexa-1,3,5-trien-2-yl]-4-propylcyclohexane |
|---|---|
| PubChem CID | 126627031 |
| Molecular Formula | C18H22F6O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[(3E,5Z)-4,6-difluoro-5-(1,1,3,3-tetrafluoroprop-2-enoxy)hexa-1,3,5-trien-2-yl]-4-propylcyclohexane |
| SMILES | C=C(/C=C(F)\C(=C\F)OC(F)(F)C=C(F)F)C1CCC(CCC)CC1 |
| InChI | InChI=1S/C18H22F6O/c1-3-4-13-5-7-14(8-6-13)12(2)9-15(20)16(11-19)25-18(23,24)10-17(21)22/h9-11,13-14H,2-8H2,1H3/b15-9+,16-11- |
| InChIKey | MCEJBEJZWXIVHL-VGJYFWKZSA-N |
| XLogP | 7.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|