C20H25F9O — CID 56621483
5-(1,1,2,2,3,3,4,4,5-nonafluoropentoxy)-2-(4-propylcyclohexyl)cyclohexa-1,3-diene (PubChem CID 56621483) has the molecular formula C20H25F9O and a molecular weight of 452.40 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,5-nonafluoropentoxy)-2-(4-propylcyclohexyl)cyclohexa-1,3-diene.
| Compound Name | 5-(1,1,2,2,3,3,4,4,5-nonafluoropentoxy)-2-(4-propylcyclohexyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 56621483 |
| Molecular Formula | C20H25F9O |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,5-nonafluoropentoxy)-2-(4-propylcyclohexyl)cyclohexa-1,3-diene |
| SMILES | CCCC1CCC(C2=CCC(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)CF)C=C2)CC1 |
| InChI | InChI=1S/C20H25F9O/c1-2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)30-20(28,29)19(26,27)18(24,25)17(22,23)12-21/h8-10,13-14,16H,2-7,11-12H2,1H3 |
| InChIKey | CEZBIACVKVHCRC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|