C28H27BrClFN4O2 — CID 126627722
(9R,13S)-13-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-3,9-dimethyl-3,7,15-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 126627722) has the molecular formula C28H27BrClFN4O2 and a molecular weight of 585.91 g/mol. Its IUPAC name is (9R,13S)-13-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-3,9-dimethyl-3,7,15-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | (9R,13S)-13-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-3,9-dimethyl-3,7,15-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 126627722 |
| Molecular Formula | C28H27BrClFN4O2 |
| Molecular Weight | 585.91 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | (9R,13S)-13-[4-(6-bromo-3-chloro-2-fluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-3,9-dimethyl-3,7,15-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | C[C@@H]1CCC[C@H](N2CCC(c3c(Br)ccc(Cl)c3F)=CC2=O)c2cc(ccn2)-c2c(ccn2C)NC1=O |
| InChI | InChI=1S/C28H27BrClFN4O2/c1-16-4-3-5-23(22-14-18(8-11-32-22)27-21(33-28(16)37)10-12-34(27)2)35-13-9-17(15-24(35)36)25-19(29)6-7-20(30)26(25)31/h6-8,10-12,14-16,23H,3-5,9,13H2,1-2H3,(H,33,37)/t16-,23+/m1/s1 |
| InChIKey | HYXBWQSAKLDGEX-MWTRTKDXSA-N |
| XLogP | 6.76 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.91 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|