C17H15FN4O3S2 — CID 126633686
3-[3-fluoro-5-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-6-methyl-1,1-dioxo-3,6-dihydro-2H-1,4-thiazin-5-amine (PubChem CID 126633686) has the molecular formula C17H15FN4O3S2 and a molecular weight of 406.46 g/mol. Its IUPAC name is 3-[3-fluoro-5-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-6-methyl-1,1-dioxo-3,6-dihydro-2H-1,4-thiazin-5-amine.
| Compound Name | 3-[3-fluoro-5-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-6-methyl-1,1-dioxo-3,6-dihydro-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 126633686 |
| Molecular Formula | C17H15FN4O3S2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 3-[3-fluoro-5-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-6-methyl-1,1-dioxo-3,6-dihydro-2H-1,4-thiazin-5-amine |
| SMILES | CC1C(N)=NC(c2sc(-c3cccc(-c4nnco4)c3)cc2F)CS1(=O)=O |
| InChI | InChI=1S/C17H15FN4O3S2/c1-9-16(19)21-13(7-27(9,23)24)15-12(18)6-14(26-15)10-3-2-4-11(5-10)17-22-20-8-25-17/h2-6,8-9,13H,7H2,1H3,(H2,19,21) |
| InChIKey | NDJCLSCBQLHDJM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |