C21H31NOS — CID 126634230
(3aS,9bS)-8-pentyl-4-(thian-4-yl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 126634230) has the molecular formula C21H31NOS and a molecular weight of 345.55 g/mol. Its IUPAC name is (3aS,9bS)-8-pentyl-4-(thian-4-yl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | (3aS,9bS)-8-pentyl-4-(thian-4-yl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 126634230 |
| Molecular Formula | C21H31NOS |
| Molecular Weight | 345.55 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (3aS,9bS)-8-pentyl-4-(thian-4-yl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | CCCCCc1ccc2c(c1)[C@H]1OCC[C@H]1C(C1CCSCC1)N2 |
| InChI | InChI=1S/C21H31NOS/c1-2-3-4-5-15-6-7-19-18(14-15)21-17(8-11-23-21)20(22-19)16-9-12-24-13-10-16/h6-7,14,16-17,20-22H,2-5,8-13H2,1H3/t17-,20?,21-/m0/s1 |
| InChIKey | BTZXWVWFOPBUPF-ZPWCZAOQSA-N |
| XLogP | 5.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|