C25H31ClFNO2 — CID 71666954
(4aS,5R,10bS)-5-cyclohexyl-9-[(4-fluorophenyl)methoxy]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride (PubChem CID 71666954) has the molecular formula C25H31ClFNO2 and a molecular weight of 431.98 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-cyclohexyl-9-[(4-fluorophenyl)methoxy]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride.
| Compound Name | (4aS,5R,10bS)-5-cyclohexyl-9-[(4-fluorophenyl)methoxy]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride |
|---|---|
| PubChem CID | 71666954 |
| Molecular Formula | C25H31ClFNO2 |
| Molecular Weight | 431.98 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (4aS,5R,10bS)-5-cyclohexyl-9-[(4-fluorophenyl)methoxy]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride |
| SMILES | Cl.Fc1ccc(COc2ccc3c(c2)[C@H]2OCCC[C@H]2[C@@H](C2CCCCC2)N3)cc1 |
| InChI | InChI=1S/C25H30FNO2.ClH/c26-19-10-8-17(9-11-19)16-29-20-12-13-23-22(15-20)25-21(7-4-14-28-25)24(27-23)18-5-2-1-3-6-18;/h8-13,15,18,21,24-25,27H,1-7,14,16H2;1H/t21-,24+,25-;/m0./s1 |
| InChIKey | AMERQOHIFHQDOE-KWMWCNIKSA-N |
| XLogP | 6.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.98 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|