C23H35ClN2O3S — CID 71666514
(4aS,5R,10bS)-5-cyclohexyl-9-piperidin-1-ylsulfonyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride (PubChem CID 71666514) has the molecular formula C23H35ClN2O3S and a molecular weight of 455.06 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-cyclohexyl-9-piperidin-1-ylsulfonyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride.
| Compound Name | (4aS,5R,10bS)-5-cyclohexyl-9-piperidin-1-ylsulfonyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride |
|---|---|
| PubChem CID | 71666514 |
| Molecular Formula | C23H35ClN2O3S |
| Molecular Weight | 455.06 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (4aS,5R,10bS)-5-cyclohexyl-9-piperidin-1-ylsulfonyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc2c(c1)[C@H]1OCCC[C@H]1[C@@H](C1CCCCC1)N2)N1CCCCC1 |
| InChI | InChI=1S/C23H34N2O3S.ClH/c26-29(27,25-13-5-2-6-14-25)18-11-12-21-20(16-18)23-19(10-7-15-28-23)22(24-21)17-8-3-1-4-9-17;/h11-12,16-17,19,22-24H,1-10,13-15H2;1H/t19-,22+,23-;/m0./s1 |
| InChIKey | SQXHOBLZYJGYBM-ZGBBJXPZSA-N |
| XLogP | 5.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.06 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |