C22H33ClFNO2 — CID 71667964
(4aS,5R,10bS)-9-butoxy-5-cyclohexyl-8-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride (PubChem CID 71667964) has the molecular formula C22H33ClFNO2 and a molecular weight of 397.96 g/mol. Its IUPAC name is (4aS,5R,10bS)-9-butoxy-5-cyclohexyl-8-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride.
| Compound Name | (4aS,5R,10bS)-9-butoxy-5-cyclohexyl-8-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride |
|---|---|
| PubChem CID | 71667964 |
| Molecular Formula | C22H33ClFNO2 |
| Molecular Weight | 397.96 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (4aS,5R,10bS)-9-butoxy-5-cyclohexyl-8-fluoro-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride |
| SMILES | CCCCOc1cc2c(cc1F)N[C@H](C1CCCCC1)[C@@H]1CCCO[C@H]21.Cl |
| InChI | InChI=1S/C22H32FNO2.ClH/c1-2-3-11-25-20-13-17-19(14-18(20)23)24-21(15-8-5-4-6-9-15)16-10-7-12-26-22(16)17;/h13-16,21-22,24H,2-12H2,1H3;1H/t16-,21+,22-;/m0./s1 |
| InChIKey | GGDXIXCAIBJSAF-UATMSEJXSA-N |
| XLogP | 6.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.96 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|