C21H32N2O3S — CID 71666947
(4aS,5R,10bS)-5-cyclopentyl-N,N-diethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-sulfonamide (PubChem CID 71666947) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-cyclopentyl-N,N-diethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-sulfonamide.
| Compound Name | (4aS,5R,10bS)-5-cyclopentyl-N,N-diethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-sulfonamide |
|---|---|
| PubChem CID | 71666947 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (4aS,5R,10bS)-5-cyclopentyl-N,N-diethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)[C@H]1OCCC[C@H]1[C@@H](C1CCCC1)N2 |
| InChI | InChI=1S/C21H32N2O3S/c1-3-23(4-2)27(24,25)16-11-12-19-18(14-16)21-17(10-7-13-26-21)20(22-19)15-8-5-6-9-15/h11-12,14-15,17,20-22H,3-10,13H2,1-2H3/t17-,20+,21-/m0/s1 |
| InChIKey | PLJZVNAOAIFFGL-WMQCIHAUSA-N |
| XLogP | 4.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |