C22H33ClN2O3S — CID 71666814
(4aS,5R,10bS)-5-cyclopentyl-9-piperidin-1-ylsulfonyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride (PubChem CID 71666814) has the molecular formula C22H33ClN2O3S and a molecular weight of 441.04 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-cyclopentyl-9-piperidin-1-ylsulfonyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride.
| Compound Name | (4aS,5R,10bS)-5-cyclopentyl-9-piperidin-1-ylsulfonyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride |
|---|---|
| PubChem CID | 71666814 |
| Molecular Formula | C22H33ClN2O3S |
| Molecular Weight | 441.04 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (4aS,5R,10bS)-5-cyclopentyl-9-piperidin-1-ylsulfonyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc2c(c1)[C@H]1OCCC[C@H]1[C@@H](C1CCCC1)N2)N1CCCCC1 |
| InChI | InChI=1S/C22H32N2O3S.ClH/c25-28(26,24-12-4-1-5-13-24)17-10-11-20-19(15-17)22-18(9-6-14-27-22)21(23-20)16-7-2-3-8-16;/h10-11,15-16,18,21-23H,1-9,12-14H2;1H/t18-,21+,22-;/m0./s1 |
| InChIKey | JXMXHBMKULCSHP-FPINAVSXSA-N |
| XLogP | 4.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |