C26H33N3O4S — CID 170925233
(3aS,4S)-4-(1-acetylpiperidin-4-yl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide (PubChem CID 170925233) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is (3aS,4S)-4-(1-acetylpiperidin-4-yl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide.
| Compound Name | (3aS,4S)-4-(1-acetylpiperidin-4-yl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 170925233 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (3aS,4S)-4-(1-acetylpiperidin-4-yl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
| SMILES | CC(=O)N1CCC([C@@H]2Nc3ccc(S(=O)(=O)Nc4ccc(C)c(C)c4)cc3C3OCC[C@H]32)CC1 |
| InChI | InChI=1S/C26H33N3O4S/c1-16-4-5-20(14-17(16)2)28-34(31,32)21-6-7-24-23(15-21)26-22(10-13-33-26)25(27-24)19-8-11-29(12-9-19)18(3)30/h4-7,14-15,19,22,25-28H,8-13H2,1-3H3/t22-,25-,26?/m0/s1 |
| InChIKey | CGUGNKFNLQTMDQ-UQVBRKOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |