C29H28N2O3S — CID 170925270
(3aS)-N-(3,4-dimethylphenyl)-4-naphthalen-1-yl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide (PubChem CID 170925270) has the molecular formula C29H28N2O3S and a molecular weight of 484.62 g/mol. Its IUPAC name is (3aS)-N-(3,4-dimethylphenyl)-4-naphthalen-1-yl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide.
| Compound Name | (3aS)-N-(3,4-dimethylphenyl)-4-naphthalen-1-yl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 170925270 |
| Molecular Formula | C29H28N2O3S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (3aS)-N-(3,4-dimethylphenyl)-4-naphthalen-1-yl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)C2OCC[C@H]2C(c2cccc4ccccc24)N3)cc1C |
| InChI | InChI=1S/C29H28N2O3S/c1-18-10-11-21(16-19(18)2)31-35(32,33)22-12-13-27-26(17-22)29-25(14-15-34-29)28(30-27)24-9-5-7-20-6-3-4-8-23(20)24/h3-13,16-17,25,28-31H,14-15H2,1-2H3/t25-,28?,29?/m0/s1 |
| InChIKey | QCSXRJZUZSXRQA-ZBOYTDAMSA-N |
| XLogP | 6.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |