C32H38N2O4S — CID 156650623
N-(3,4-dimethylphenyl)-4-[4-(2-ethylpentanoyl)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide (PubChem CID 156650623) has the molecular formula C32H38N2O4S and a molecular weight of 546.73 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-[4-(2-ethylpentanoyl)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-[4-(2-ethylpentanoyl)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 156650623 |
| Molecular Formula | C32H38N2O4S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-[4-(2-ethylpentanoyl)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
| SMILES | CCCC(CC)C(=O)c1ccc(C2Nc3ccc(S(=O)(=O)Nc4ccc(C)c(C)c4)cc3C3OCCC23)cc1 |
| InChI | InChI=1S/C32H38N2O4S/c1-5-7-22(6-2)31(35)24-11-9-23(10-12-24)30-27-16-17-38-32(27)28-19-26(14-15-29(28)33-30)39(36,37)34-25-13-8-20(3)21(4)18-25/h8-15,18-19,22,27,30,32-34H,5-7,16-17H2,1-4H3 |
| InChIKey | ZNKZCVMJDXEDPI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |