C29H26F6N2O4S — CID 170925262
(3aS,4R,9bS)-N-[3,4-bis(trifluoromethyl)phenyl]-4-[4-(2-methylpropanoyl)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide (PubChem CID 170925262) has the molecular formula C29H26F6N2O4S and a molecular weight of 612.59 g/mol. Its IUPAC name is (3aS,4R,9bS)-N-[3,4-bis(trifluoromethyl)phenyl]-4-[4-(2-methylpropanoyl)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide.
| Compound Name | (3aS,4R,9bS)-N-[3,4-bis(trifluoromethyl)phenyl]-4-[4-(2-methylpropanoyl)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 170925262 |
| Molecular Formula | C29H26F6N2O4S |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | (3aS,4R,9bS)-N-[3,4-bis(trifluoromethyl)phenyl]-4-[4-(2-methylpropanoyl)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
| SMILES | CC(C)C(=O)c1ccc([C@@H]2Nc3ccc(S(=O)(=O)Nc4ccc(C(F)(F)F)c(C(F)(F)F)c4)cc3[C@H]3OCC[C@H]32)cc1 |
| InChI | InChI=1S/C29H26F6N2O4S/c1-15(2)26(38)17-5-3-16(4-6-17)25-20-11-12-41-27(20)21-14-19(8-10-24(21)36-25)42(39,40)37-18-7-9-22(28(30,31)32)23(13-18)29(33,34)35/h3-10,13-15,20,25,27,36-37H,11-12H2,1-2H3/t20-,25-,27-/m0/s1 |
| InChIKey | IVCBFOMCXMJSPN-OICBGKIFSA-N |
| XLogP | 7.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |