C32H30N2O4S — CID 170925242
(3aS,4R)-4-(4-benzoylphenyl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide (PubChem CID 170925242) has the molecular formula C32H30N2O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is (3aS,4R)-4-(4-benzoylphenyl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide.
| Compound Name | (3aS,4R)-4-(4-benzoylphenyl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 170925242 |
| Molecular Formula | C32H30N2O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | (3aS,4R)-4-(4-benzoylphenyl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)C2OCC[C@H]2[C@H](c2ccc(C(=O)c4ccccc4)cc2)N3)cc1C |
| InChI | InChI=1S/C32H30N2O4S/c1-20-8-13-25(18-21(20)2)34-39(36,37)26-14-15-29-28(19-26)32-27(16-17-38-32)30(33-29)22-9-11-24(12-10-22)31(35)23-6-4-3-5-7-23/h3-15,18-19,27,30,32-34H,16-17H2,1-2H3/t27-,30-,32?/m0/s1 |
| InChIKey | LGWZOCSNLXZHTB-QDBBHCTGSA-N |
| XLogP | 6.58 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |