C27H28N2O4S — CID 159097043
(3aS,9bS)-4-(3-acetylphenyl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide (PubChem CID 159097043) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is (3aS,9bS)-4-(3-acetylphenyl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide.
| Compound Name | (3aS,9bS)-4-(3-acetylphenyl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 159097043 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | (3aS,9bS)-4-(3-acetylphenyl)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
| SMILES | CC(=O)c1cccc(C2Nc3ccc(S(=O)(=O)Nc4ccc(C)c(C)c4)cc3[C@H]3OCC[C@@H]23)c1 |
| InChI | InChI=1S/C27H28N2O4S/c1-16-7-8-21(13-17(16)2)29-34(31,32)22-9-10-25-24(15-22)27-23(11-12-33-27)26(28-25)20-6-4-5-19(14-20)18(3)30/h4-10,13-15,23,26-29H,11-12H2,1-3H3/t23-,26?,27-/m0/s1 |
| InChIKey | KCUMAXONMYVHRZ-BBDOPMDFSA-N |
| XLogP | 5.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |