C19H23N3O2S — CID 156650599
(3aS,9bS)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-sulfonamide (PubChem CID 156650599) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is (3aS,9bS)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-sulfonamide.
| Compound Name | (3aS,9bS)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 156650599 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (3aS,9bS)-N-(3,4-dimethylphenyl)-2,3,3a,4,5,9b-hexahydro-1H-pyrrolo[3,2-c]quinoline-8-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc3c(c2)[C@H]2NCC[C@H]2CN3)cc1C |
| InChI | InChI=1S/C19H23N3O2S/c1-12-3-4-15(9-13(12)2)22-25(23,24)16-5-6-18-17(10-16)19-14(11-21-18)7-8-20-19/h3-6,9-10,14,19-22H,7-8,11H2,1-2H3/t14-,19-/m0/s1 |
| InChIKey | PAFTXLACLJPHJA-LIRRHRJNSA-N |
| XLogP | 3.18 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |