C23H28Br2N2O3S — CID 156650721
cyclohexane;N-(3,4-dibromophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide (PubChem CID 156650721) has the molecular formula C23H28Br2N2O3S and a molecular weight of 572.36 g/mol. Its IUPAC name is cyclohexane;N-(3,4-dibromophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide.
| Compound Name | cyclohexane;N-(3,4-dibromophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 156650721 |
| Molecular Formula | C23H28Br2N2O3S |
| Molecular Weight | 572.36 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | cyclohexane;N-(3,4-dibromophenyl)-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide |
| SMILES | C1CCCCC1.O=S(=O)(Nc1ccc(Br)c(Br)c1)c1ccc2c(c1)C1OCCC1CN2 |
| InChI | InChI=1S/C17H16Br2N2O3S.C6H12/c18-14-3-1-11(7-15(14)19)21-25(22,23)12-2-4-16-13(8-12)17-10(9-20-16)5-6-24-17;1-2-4-6-5-3-1/h1-4,7-8,10,17,20-21H,5-6,9H2;1-6H2 |
| InChIKey | QIEYFDXIGDXBJH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.36 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |