C25H35N3O3S — CID 156650690
(3aS)-N-[3-(dimethylamino)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide;cyclohexane (PubChem CID 156650690) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is (3aS)-N-[3-(dimethylamino)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide;cyclohexane.
| Compound Name | (3aS)-N-[3-(dimethylamino)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide;cyclohexane |
|---|---|
| PubChem CID | 156650690 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (3aS)-N-[3-(dimethylamino)phenyl]-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline-8-sulfonamide;cyclohexane |
| SMILES | C1CCCCC1.CN(C)c1cccc(NS(=O)(=O)c2ccc3c(c2)C2OCC[C@H]2CN3)c1 |
| InChI | InChI=1S/C19H23N3O3S.C6H12/c1-22(2)15-5-3-4-14(10-15)21-26(23,24)16-6-7-18-17(11-16)19-13(12-20-18)8-9-25-19;1-2-4-6-5-3-1/h3-7,10-11,13,19-21H,8-9,12H2,1-2H3;1-6H2/t13-,19?;/m0./s1 |
| InChIKey | CROVOFOAUOSUSB-VMZFVTBHSA-N |
| XLogP | 5.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_H(6)', 'substructure': 'N/A'} |
|---|