C22H31NO3 — CID 126634504
propyl (4aS,5R)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carboxylate (PubChem CID 126634504) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is propyl (4aS,5R)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carboxylate.
| Compound Name | propyl (4aS,5R)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 126634504 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | propyl (4aS,5R)-5-cyclohexyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carboxylate |
| SMILES | CCCOC(=O)c1ccc2c(c1)C1OCCC[C@H]1[C@@H](C1CCCCC1)N2 |
| InChI | InChI=1S/C22H31NO3/c1-2-12-26-22(24)16-10-11-19-18(14-16)21-17(9-6-13-25-21)20(23-19)15-7-4-3-5-8-15/h10-11,14-15,17,20-21,23H,2-9,12-13H2,1H3/t17-,20+,21?/m0/s1 |
| InChIKey | YSUIWBRDDZSFRV-DVUUQMMQSA-N |
| XLogP | 5.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |