C17H25NO2 — CID 163853713
(4aS,5S,10bS)-9-butoxy-5-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 163853713) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (4aS,5S,10bS)-9-butoxy-5-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5S,10bS)-9-butoxy-5-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 163853713 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (4aS,5S,10bS)-9-butoxy-5-methyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CCCCOc1ccc2c(c1)[C@H]1OCCC[C@H]1[C@H](C)N2 |
| InChI | InChI=1S/C17H25NO2/c1-3-4-9-19-13-7-8-16-15(11-13)17-14(12(2)18-16)6-5-10-20-17/h7-8,11-12,14,17-18H,3-6,9-10H2,1-2H3/t12-,14-,17-/m0/s1 |
| InChIKey | OWNUMDGJFYCSOO-JDFRZJQESA-N |
| XLogP | 4.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|